C25H21I — CID 70999827
2-(5,6-dihydronaphthalen-2-yl)-7-iodo-9,9-dimethylfluorene (PubChem CID 70999827) has the molecular formula C25H21I and a molecular weight of 448.35 g/mol. Its IUPAC name is 2-(5,6-dihydronaphthalen-2-yl)-7-iodo-9,9-dimethylfluorene.
| Compound Name | 2-(5,6-dihydronaphthalen-2-yl)-7-iodo-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 70999827 |
| Molecular Formula | C25H21I |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 2-(5,6-dihydronaphthalen-2-yl)-7-iodo-9,9-dimethylfluorene |
| SMILES | CC1(C)c2cc(I)ccc2-c2ccc(-c3ccc4c(c3)C=CCC4)cc21 |
| InChI | InChI=1S/C25H21I/c1-25(2)23-14-19(18-8-7-16-5-3-4-6-17(16)13-18)9-11-21(23)22-12-10-20(26)15-24(22)25/h4,6-15H,3,5H2,1-2H3 |
| InChIKey | FKWAWGOSHQTVRP-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|