C26H27I — CID 70994305
2-[3-ethyl-2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]-7-iodo-9,9-dimethylfluorene (PubChem CID 70994305) has the molecular formula C26H27I and a molecular weight of 466.41 g/mol. Its IUPAC name is 2-[3-ethyl-2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]-7-iodo-9,9-dimethylfluorene.
| Compound Name | 2-[3-ethyl-2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]-7-iodo-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 70994305 |
| Molecular Formula | C26H27I |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 2-[3-ethyl-2-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]-7-iodo-9,9-dimethylfluorene |
| SMILES | C/C=C\C1=C(c2ccc3c(c2)C(C)(C)c2cc(I)ccc2-3)C=CCC1CC |
| InChI | InChI=1S/C26H27I/c1-5-8-20-17(6-2)9-7-10-21(20)18-11-13-22-23-14-12-19(27)16-25(23)26(3,4)24(22)15-18/h5,7-8,10-17H,6,9H2,1-4H3/b8-5- |
| InChIKey | FHLGERLYSNUSSN-YVMONPNESA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|