About (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene
(2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene (PubChem CID 173486701) has the molecular formula C17H19I
and a molecular weight of 350.24 g/mol. Its IUPAC name is (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene.
Molecular Properties
| Compound Name | (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene |
| PubChem CID | 173486701 |
| Molecular Formula | C17H19I |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene |
| SMILES | C=CC=C1/C(=C\CC)C(C)(C)c2cc(I)ccc21 |
| InChI | InChI=1S/C17H19I/c1-5-7-13-14-10-9-12(18)11-16(14)17(3,4)15(13)8-6-2/h5,7-11H,1,6H2,2-4H3/b13-7?,15-8+ |
| InChIKey | GXTMMCBNVVQPEA-GBSXSVLBSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene?
The IUPAC name of (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene (CID 173486701) is (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene.
What is the SMILES notation for (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene?
The canonical SMILES for (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene is C=CC=C1/C(=C\CC)C(C)(C)c2cc(I)ccc21.
What is the InChIKey of (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene?
The InChIKey is GXTMMCBNVVQPEA-GBSXSVLBSA-N. The full InChI is InChI=1S/C17H19I/c1-5-7-13-14-10-9-12(18)11-16(14)17(3,4)15(13)8-6-2/h5,7-11H,1,6H2,2-4H3/b13-7?,15-8+.
What are the key properties of (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene?
(2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene has a molecular weight of 350.24 g/mol, XLogP of 5.49, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-6-iodo-1,1-dimethyl-3-prop-2-enylidene-2-propylideneindene is sourced from PubChem (CID 173486701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).