C16H19I — CID 89170468
3-ethenyl-6-iodo-1,1-dimethyl-2-propylindene (PubChem CID 89170468) has the molecular formula C16H19I and a molecular weight of 338.23 g/mol. Its IUPAC name is 3-ethenyl-6-iodo-1,1-dimethyl-2-propylindene.
| Compound Name | 3-ethenyl-6-iodo-1,1-dimethyl-2-propylindene |
|---|---|
| PubChem CID | 89170468 |
| Molecular Formula | C16H19I |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 3-ethenyl-6-iodo-1,1-dimethyl-2-propylindene |
| SMILES | C=CC1=C(CCC)C(C)(C)c2cc(I)ccc21 |
| InChI | InChI=1S/C16H19I/c1-5-7-14-12(6-2)13-9-8-11(17)10-15(13)16(14,3)4/h6,8-10H,2,5,7H2,1,3-4H3 |
| InChIKey | GWAUYONYPJZUBP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|