C24H27I — CID 135164402
2-iodo-7-methyl-9,9-bis(pent-4-enyl)fluorene (PubChem CID 135164402) has the molecular formula C24H27I and a molecular weight of 442.38 g/mol. Its IUPAC name is 2-iodo-7-methyl-9,9-bis(pent-4-enyl)fluorene.
| Compound Name | 2-iodo-7-methyl-9,9-bis(pent-4-enyl)fluorene |
|---|---|
| PubChem CID | 135164402 |
| Molecular Formula | C24H27I |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-iodo-7-methyl-9,9-bis(pent-4-enyl)fluorene |
| SMILES | C=CCCCC1(CCCC=C)c2cc(C)ccc2-c2ccc(I)cc21 |
| InChI | InChI=1S/C24H27I/c1-4-6-8-14-24(15-9-7-5-2)22-16-18(3)10-12-20(22)21-13-11-19(25)17-23(21)24/h4-5,10-13,16-17H,1-2,6-9,14-15H2,3H3 |
| InChIKey | TYLWPOLFNWVTCL-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|