C55H60N2 — CID 140895786
9,9-bis(hex-5-enyl)-2-N,7-N-diphenyl-2-N,7-N-bis(2,4,6-trimethylphenyl)fluorene-2,7-diamine (PubChem CID 140895786) has the molecular formula C55H60N2 and a molecular weight of 749.10 g/mol. Its IUPAC name is 9,9-bis(hex-5-enyl)-2-N,7-N-diphenyl-2-N,7-N-bis(2,4,6-trimethylphenyl)fluorene-2,7-diamine.
| Compound Name | 9,9-bis(hex-5-enyl)-2-N,7-N-diphenyl-2-N,7-N-bis(2,4,6-trimethylphenyl)fluorene-2,7-diamine |
|---|---|
| PubChem CID | 140895786 |
| Molecular Formula | C55H60N2 |
| Molecular Weight | 749.10 g/mol |
| Exact Mass | 748.48 |
| IUPAC Name | 9,9-bis(hex-5-enyl)-2-N,7-N-diphenyl-2-N,7-N-bis(2,4,6-trimethylphenyl)fluorene-2,7-diamine |
| SMILES | C=CCCCCC1(CCCCC=C)c2cc(N(c3ccccc3)c3c(C)cc(C)cc3C)ccc2-c2ccc(N(c3ccccc3)c3c(C)cc(C)cc3C)cc21 |
| InChI | InChI=1S/C55H60N2/c1-9-11-13-21-31-55(32-22-14-12-10-2)51-37-47(56(45-23-17-15-18-24-45)53-41(5)33-39(3)34-42(53)6)27-29-49(51)50-30-28-48(38-52(50)55)57(46-25-19-16-20-26-46)54-43(7)35-40(4)36-44(54)8/h9-10,15-20,23-30,33-38H,1-2,11-14,21-22,31-32H2,3-8H3 |
| InChIKey | GYIWWFORVAFACO-UHFFFAOYSA-N |
| XLogP | 16.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.10 |
| LogP ≤ 5 | 16.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|