C45H38N4 — CID 14597878
3-[9-(2-cyanoethyl)-2,7-bis(N-(3-methylphenyl)anilino)fluoren-9-yl]propanenitrile (PubChem CID 14597878) has the molecular formula C45H38N4 and a molecular weight of 634.83 g/mol. Its IUPAC name is 3-[9-(2-cyanoethyl)-2,7-bis(N-(3-methylphenyl)anilino)fluoren-9-yl]propanenitrile.
| Compound Name | 3-[9-(2-cyanoethyl)-2,7-bis(N-(3-methylphenyl)anilino)fluoren-9-yl]propanenitrile |
|---|---|
| PubChem CID | 14597878 |
| Molecular Formula | C45H38N4 |
| Molecular Weight | 634.83 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | 3-[9-(2-cyanoethyl)-2,7-bis(N-(3-methylphenyl)anilino)fluoren-9-yl]propanenitrile |
| SMILES | Cc1cccc(N(c2ccccc2)c2ccc3c(c2)C(CCC#N)(CCC#N)c2cc(N(c4ccccc4)c4cccc(C)c4)ccc2-3)c1 |
| InChI | InChI=1S/C45H38N4/c1-33-13-9-19-37(29-33)48(35-15-5-3-6-16-35)39-21-23-41-42-24-22-40(32-44(42)45(25-11-27-46,26-12-28-47)43(41)31-39)49(36-17-7-4-8-18-36)38-20-10-14-34(2)30-38/h3-10,13-24,29-32H,11-12,25-26H2,1-2H3 |
| InChIKey | MWJHGLYWEJAPRF-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.83 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |