C26H25I — CID 173487010
1-[(2Z)-2-(2-iodoethylidene)-3,3-dimethyl-1-prop-2-enylideneinden-5-yl]-2,3-dihydronaphthalene (PubChem CID 173487010) has the molecular formula C26H25I and a molecular weight of 464.39 g/mol. Its IUPAC name is 1-[(2Z)-2-(2-iodoethylidene)-3,3-dimethyl-1-prop-2-enylideneinden-5-yl]-2,3-dihydronaphthalene.
| Compound Name | 1-[(2Z)-2-(2-iodoethylidene)-3,3-dimethyl-1-prop-2-enylideneinden-5-yl]-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 173487010 |
| Molecular Formula | C26H25I |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 1-[(2Z)-2-(2-iodoethylidene)-3,3-dimethyl-1-prop-2-enylideneinden-5-yl]-2,3-dihydronaphthalene |
| SMILES | C=CC=C1/C(=C\CI)C(C)(C)c2cc(C3=c4ccccc4=CCC3)ccc21 |
| InChI | InChI=1S/C26H25I/c1-4-8-22-23-14-13-19(17-25(23)26(2,3)24(22)15-16-27)21-12-7-10-18-9-5-6-11-20(18)21/h4-6,8-11,13-15,17H,1,7,12,16H2,2-3H3/b22-8?,24-15+ |
| InChIKey | KBIVUTIIKKSOPD-OTDBWDRKSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|