C25H25I — CID 173486990
5-[(2Z)-1-ethylidene-2-(2-iodoethylidene)-3,3-dimethylinden-5-yl]-1,2-dihydronaphthalene (PubChem CID 173486990) has the molecular formula C25H25I and a molecular weight of 452.38 g/mol. Its IUPAC name is 5-[(2Z)-1-ethylidene-2-(2-iodoethylidene)-3,3-dimethylinden-5-yl]-1,2-dihydronaphthalene.
| Compound Name | 5-[(2Z)-1-ethylidene-2-(2-iodoethylidene)-3,3-dimethylinden-5-yl]-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 173486990 |
| Molecular Formula | C25H25I |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 5-[(2Z)-1-ethylidene-2-(2-iodoethylidene)-3,3-dimethylinden-5-yl]-1,2-dihydronaphthalene |
| SMILES | CC=C1/C(=C\CI)C(C)(C)c2cc(-c3cccc4c3C=CCC4)ccc21 |
| InChI | InChI=1S/C25H25I/c1-4-19-22-13-12-18(16-24(22)25(2,3)23(19)14-15-26)21-11-7-9-17-8-5-6-10-20(17)21/h4,6-7,9-14,16H,5,8,15H2,1-3H3/b19-4?,23-14+ |
| InChIKey | BFVQVKBLQBKBJV-CRGMIXLYSA-N |
| XLogP | 7.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|