C21H26 — CID 143227246
(2Z,3E)-2-but-3-enylidene-1,1,6-trimethyl-3-(2-methylbut-3-enylidene)indene (PubChem CID 143227246) has the molecular formula C21H26 and a molecular weight of 278.44 g/mol. Its IUPAC name is (2Z,3E)-2-but-3-enylidene-1,1,6-trimethyl-3-(2-methylbut-3-enylidene)indene.
| Compound Name | (2Z,3E)-2-but-3-enylidene-1,1,6-trimethyl-3-(2-methylbut-3-enylidene)indene |
|---|---|
| PubChem CID | 143227246 |
| Molecular Formula | C21H26 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (2Z,3E)-2-but-3-enylidene-1,1,6-trimethyl-3-(2-methylbut-3-enylidene)indene |
| SMILES | C=CC/C=C1C(=C/C(C)C=C)\c2ccc(C)cc2C\1(C)C |
| InChI | InChI=1S/C21H26/c1-7-9-10-19-18(13-15(3)8-2)17-12-11-16(4)14-20(17)21(19,5)6/h7-8,10-15H,1-2,9H2,3-6H3/b18-13-,19-10+ |
| InChIKey | ZBZHKHBEFCUWRM-DZPGJBBUSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|