C27H28 — CID 123535187
2-(2-but-3-en-2-yl-4-methylphenyl)-7,9,9-trimethylfluorene (PubChem CID 123535187) has the molecular formula C27H28 and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-(2-but-3-en-2-yl-4-methylphenyl)-7,9,9-trimethylfluorene.
| Compound Name | 2-(2-but-3-en-2-yl-4-methylphenyl)-7,9,9-trimethylfluorene |
|---|---|
| PubChem CID | 123535187 |
| Molecular Formula | C27H28 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-(2-but-3-en-2-yl-4-methylphenyl)-7,9,9-trimethylfluorene |
| SMILES | C=CC(C)c1cc(C)ccc1-c1ccc2c(c1)C(C)(C)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C27H28/c1-7-19(4)24-14-17(2)8-11-21(24)20-10-13-23-22-12-9-18(3)15-25(22)27(5,6)26(23)16-20/h7-16,19H,1H2,2-6H3 |
| InChIKey | IEYXPQNYSLJFNU-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|