C23H24S — CID 58880749
2,3,4-trimethyl-5-(7,9,9-trimethylfluoren-2-yl)thiophene (PubChem CID 58880749) has the molecular formula C23H24S and a molecular weight of 332.51 g/mol. Its IUPAC name is 2,3,4-trimethyl-5-(7,9,9-trimethylfluoren-2-yl)thiophene.
| Compound Name | 2,3,4-trimethyl-5-(7,9,9-trimethylfluoren-2-yl)thiophene |
|---|---|
| PubChem CID | 58880749 |
| Molecular Formula | C23H24S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2,3,4-trimethyl-5-(7,9,9-trimethylfluoren-2-yl)thiophene |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(-c3sc(C)c(C)c3C)ccc1-2 |
| InChI | InChI=1S/C23H24S/c1-13-7-9-18-19-10-8-17(22-15(3)14(2)16(4)24-22)12-21(19)23(5,6)20(18)11-13/h7-12H,1-6H3 |
| InChIKey | LGUCGMXPIFFZRG-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |