C43H41N3 — CID 134603840
4-(5,6-dihydronaphthalen-2-yl)-2-(9,9-dimethyl-4a,9a-dihydrofluoren-2-yl)-6-(9,9-dimethylfluoren-2-yl)-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 134603840) has the molecular formula C43H41N3 and a molecular weight of 599.82 g/mol. Its IUPAC name is 4-(5,6-dihydronaphthalen-2-yl)-2-(9,9-dimethyl-4a,9a-dihydrofluoren-2-yl)-6-(9,9-dimethylfluoren-2-yl)-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 4-(5,6-dihydronaphthalen-2-yl)-2-(9,9-dimethyl-4a,9a-dihydrofluoren-2-yl)-6-(9,9-dimethylfluoren-2-yl)-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 134603840 |
| Molecular Formula | C43H41N3 |
| Molecular Weight | 599.82 g/mol |
| Exact Mass | 599.33 |
| IUPAC Name | 4-(5,6-dihydronaphthalen-2-yl)-2-(9,9-dimethyl-4a,9a-dihydrofluoren-2-yl)-6-(9,9-dimethylfluoren-2-yl)-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2ccc(C3=NC(c4ccc5c(c4)C=CCC5)NC(C4=CC5C(C=C4)c4ccccc4C5(C)C)N3)cc21 |
| InChI | InChI=1S/C43H41N3/c1-42(2)35-15-9-7-13-31(35)33-21-19-29(24-37(33)42)40-44-39(28-18-17-26-11-5-6-12-27(26)23-28)45-41(46-40)30-20-22-34-32-14-8-10-16-36(32)43(3,4)38(34)25-30/h6-10,12-25,33,37,39-40,44H,5,11H2,1-4H3,(H,45,46) |
| InChIKey | CLAKPYQASOTQJG-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.82 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |