C43H34N4 — CID 129099191
7-[4-[2-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]phenyl]-9,9-dimethylfluorene-1-carbonitrile (PubChem CID 129099191) has the molecular formula C43H34N4 and a molecular weight of 606.77 g/mol. Its IUPAC name is 7-[4-[2-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]phenyl]-9,9-dimethylfluorene-1-carbonitrile.
| Compound Name | 7-[4-[2-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]phenyl]-9,9-dimethylfluorene-1-carbonitrile |
|---|---|
| PubChem CID | 129099191 |
| Molecular Formula | C43H34N4 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 7-[4-[2-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]phenyl]-9,9-dimethylfluorene-1-carbonitrile |
| SMILES | CC1(C)c2cc(-c3ccc(-c4ccccc4C4NC(c5ccccc5)=NC(c5ccccc5)N4)cc3)ccc2-c2cccc(C#N)c21 |
| InChI | InChI=1S/C43H34N4/c1-43(2)38-26-32(24-25-35(38)36-19-11-16-33(27-44)39(36)43)28-20-22-29(23-21-28)34-17-9-10-18-37(34)42-46-40(30-12-5-3-6-13-30)45-41(47-42)31-14-7-4-8-15-31/h3-26,40,42,46H,1-2H3,(H,45,47) |
| InChIKey | KWRUJTBVZVGTSF-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |