C48H35FN6 — CID 174267887
2-[4-[2-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]-3-(4-fluorophenyl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 174267887) has the molecular formula C48H35FN6 and a molecular weight of 714.85 g/mol. Its IUPAC name is 2-[4-[2-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]-3-(4-fluorophenyl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[2-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]-3-(4-fluorophenyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174267887 |
| Molecular Formula | C48H35FN6 |
| Molecular Weight | 714.85 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | 2-[4-[2-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]-3-(4-fluorophenyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Fc1ccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccccc2C2NC(c3ccccc3)=NC(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C48H35FN6/c49-38-28-25-32(26-29-38)42-31-37(47-52-43(33-15-5-1-6-16-33)50-44(53-47)34-17-7-2-8-18-34)27-30-40(42)39-23-13-14-24-41(39)48-54-45(35-19-9-3-10-20-35)51-46(55-48)36-21-11-4-12-22-36/h1-31,45,48,54H,(H,51,55) |
| InChIKey | HIKUAPXNYKDTDT-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.85 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |