C53H44N6 — CID 174267888
2-[4-[2-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]-3-(2,3,4,5,6-pentamethylphenyl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 174267888) has the molecular formula C53H44N6 and a molecular weight of 764.98 g/mol. Its IUPAC name is 2-[4-[2-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]-3-(2,3,4,5,6-pentamethylphenyl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[2-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]-3-(2,3,4,5,6-pentamethylphenyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174267888 |
| Molecular Formula | C53H44N6 |
| Molecular Weight | 764.98 g/mol |
| Exact Mass | 764.36 |
| IUPAC Name | 2-[4-[2-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]-3-(2,3,4,5,6-pentamethylphenyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1c(C)c(C)c(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccccc2C2=NC(c3ccccc3)=NC(c3ccccc3)N2)c(C)c1C |
| InChI | InChI=1S/C53H44N6/c1-33-34(2)36(4)47(37(5)35(33)3)46-32-42(52-56-48(38-20-10-6-11-21-38)54-49(57-52)39-22-12-7-13-23-39)30-31-44(46)43-28-18-19-29-45(43)53-58-50(40-24-14-8-15-25-40)55-51(59-53)41-26-16-9-17-27-41/h6-32,50H,1-5H3,(H,55,58,59) |
| InChIKey | PBJHWDKQSYNYPJ-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.98 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |