C45H31N3O — CID 166961451
2,4-diphenyl-6-[9-[3-(4-phenylphenyl)phenyl]dibenzofuran-1-yl]-1,2-dihydro-1,3,5-triazine (PubChem CID 166961451) has the molecular formula C45H31N3O and a molecular weight of 629.76 g/mol. Its IUPAC name is 2,4-diphenyl-6-[9-[3-(4-phenylphenyl)phenyl]dibenzofuran-1-yl]-1,2-dihydro-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[9-[3-(4-phenylphenyl)phenyl]dibenzofuran-1-yl]-1,2-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 166961451 |
| Molecular Formula | C45H31N3O |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | 2,4-diphenyl-6-[9-[3-(4-phenylphenyl)phenyl]dibenzofuran-1-yl]-1,2-dihydro-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3ccccc3)NC(c3cccc4oc5cccc(-c6cccc(-c7ccc(-c8ccccc8)cc7)c6)c5c34)=N2)cc1 |
| InChI | InChI=1S/C45H31N3O/c1-4-13-30(14-5-1)31-25-27-32(28-26-31)35-19-10-20-36(29-35)37-21-11-23-39-41(37)42-38(22-12-24-40(42)49-39)45-47-43(33-15-6-2-7-16-33)46-44(48-45)34-17-8-3-9-18-34/h1-29,43H,(H,46,47,48) |
| InChIKey | BPZBIDHNNHUDEV-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |