C48H34N6 — CID 166022884
2,4-diphenyl-6-[3-[3-[2-phenyl-4-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]phenyl]-1,3,5-triazine (PubChem CID 166022884) has the molecular formula C48H34N6 and a molecular weight of 694.84 g/mol. Its IUPAC name is 2,4-diphenyl-6-[3-[3-[2-phenyl-4-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[3-[3-[2-phenyl-4-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166022884 |
| Molecular Formula | C48H34N6 |
| Molecular Weight | 694.84 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | 2,4-diphenyl-6-[3-[3-[2-phenyl-4-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(C3=NC(c4ccccc4)NC(c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)c5)c4)=N3)cc2)cc1 |
| InChI | InChI=1S/C48H34N6/c1-5-15-33(16-6-1)34-27-29-38(30-28-34)46-50-45(37-21-11-4-12-22-37)53-48(54-46)42-26-14-24-40(32-42)39-23-13-25-41(31-39)47-51-43(35-17-7-2-8-18-35)49-44(52-47)36-19-9-3-10-20-36/h1-32,45H,(H,50,53,54) |
| InChIKey | KEQKHYQAZYYMRG-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.84 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |