C54H36N6O — CID 163582620
2-[8-[3-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]dibenzofuran-1-yl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 163582620) has the molecular formula C54H36N6O and a molecular weight of 784.92 g/mol. Its IUPAC name is 2-[8-[3-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]dibenzofuran-1-yl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[8-[3-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]dibenzofuran-1-yl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 163582620 |
| Molecular Formula | C54H36N6O |
| Molecular Weight | 784.92 g/mol |
| Exact Mass | 784.30 |
| IUPAC Name | 2-[8-[3-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]dibenzofuran-1-yl]-4-phenyl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3cccc(-c4ccc5oc6cccc(-c7nc(-c8ccccc8)nc(-c8ccc(-c9ccccc9)cc8)n7)c6c5c4)c3)NC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C54H36N6O/c1-5-15-35(16-6-1)36-27-29-40(30-28-36)52-56-51(39-21-11-4-12-22-39)59-54(60-52)44-25-14-26-47-48(44)45-34-42(31-32-46(45)61-47)41-23-13-24-43(33-41)53-57-49(37-17-7-2-8-18-37)55-50(58-53)38-19-9-3-10-20-38/h1-34,53H,(H,55,57,58) |
| InChIKey | GIVIKLLXLMTPJX-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.92 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |