C57H39N5 — CID 163755710
2-[3-[4-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]phenyl]-4,9-diphenyl-1,10-phenanthroline (PubChem CID 163755710) has the molecular formula C57H39N5 and a molecular weight of 793.97 g/mol. Its IUPAC name is 2-[3-[4-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]phenyl]-4,9-diphenyl-1,10-phenanthroline.
| Compound Name | 2-[3-[4-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]phenyl]-4,9-diphenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 163755710 |
| Molecular Formula | C57H39N5 |
| Molecular Weight | 793.97 g/mol |
| Exact Mass | 793.32 |
| IUPAC Name | 2-[3-[4-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]phenyl]-4,9-diphenyl-1,10-phenanthroline |
| SMILES | c1ccc(C2=NC(c3ccccc3)NC(c3cccc(-c4ccc(-c5cccc(-c6cc(-c7ccccc7)c7ccc8ccc(-c9ccccc9)nc8c7n6)c5)cc4)c3)=N2)cc1 |
| InChI | InChI=1S/C57H39N5/c1-5-15-40(16-6-1)50-37-52(59-54-49(50)33-31-42-32-34-51(58-53(42)54)41-17-7-2-8-18-41)47-25-13-23-45(35-47)38-27-29-39(30-28-38)46-24-14-26-48(36-46)57-61-55(43-19-9-3-10-20-43)60-56(62-57)44-21-11-4-12-22-44/h1-37,55H,(H,60,61,62) |
| InChIKey | LTVXBILLLWYWNN-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.97 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|