C43H32N4 — CID 154940521
4-[4-[4-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]naphthalen-1-yl]aniline (PubChem CID 154940521) has the molecular formula C43H32N4 and a molecular weight of 604.76 g/mol. Its IUPAC name is 4-[4-[4-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]naphthalen-1-yl]aniline.
| Compound Name | 4-[4-[4-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]naphthalen-1-yl]aniline |
|---|---|
| PubChem CID | 154940521 |
| Molecular Formula | C43H32N4 |
| Molecular Weight | 604.76 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | 4-[4-[4-[3-(2,4-diphenyl-1,2-dihydro-1,3,5-triazin-6-yl)phenyl]phenyl]naphthalen-1-yl]aniline |
| SMILES | Nc1ccc(-c2ccc(-c3ccc(-c4cccc(C5=NC(c6ccccc6)=NC(c6ccccc6)N5)c4)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C43H32N4/c44-36-24-22-31(23-25-36)38-27-26-37(39-16-7-8-17-40(38)39)30-20-18-29(19-21-30)34-14-9-15-35(28-34)43-46-41(32-10-3-1-4-11-32)45-42(47-43)33-12-5-2-6-13-33/h1-28,41H,44H2,(H,45,46,47) |
| InChIKey | QTPIVUGXFBBPMS-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.76 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|