C47H35N5 — CID 148755581
4-[4-[4-(2,4-diphenyl-1,2-dihydropyrimidin-6-yl)phenyl]naphthalen-1-yl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine (PubChem CID 148755581) has the molecular formula C47H35N5 and a molecular weight of 669.83 g/mol. Its IUPAC name is 4-[4-[4-(2,4-diphenyl-1,2-dihydropyrimidin-6-yl)phenyl]naphthalen-1-yl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine.
| Compound Name | 4-[4-[4-(2,4-diphenyl-1,2-dihydropyrimidin-6-yl)phenyl]naphthalen-1-yl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 148755581 |
| Molecular Formula | C47H35N5 |
| Molecular Weight | 669.83 g/mol |
| Exact Mass | 669.29 |
| IUPAC Name | 4-[4-[4-(2,4-diphenyl-1,2-dihydropyrimidin-6-yl)phenyl]naphthalen-1-yl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine |
| SMILES | C1=C(c2ccc(-c3ccc(C4=NC(c5ccccc5)NC(c5ccccc5)=N4)c4ccccc34)cc2)NC(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C47H35N5/c1-5-15-33(16-6-1)42-31-43(49-44(48-42)35-17-7-2-8-18-35)34-27-25-32(26-28-34)38-29-30-41(40-24-14-13-23-39(38)40)47-51-45(36-19-9-3-10-20-36)50-46(52-47)37-21-11-4-12-22-37/h1-31,44-45,49H,(H,50,51,52) |
| InChIKey | JNBNOPTWNCTMTO-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 61.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.83 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |