About 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine
4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine (PubChem CID 130392498) has the molecular formula C37H32N2
and a molecular weight of 504.68 g/mol. Its IUPAC name is 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine.
Molecular Properties
| Compound Name | 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine |
| PubChem CID | 130392498 |
| Molecular Formula | C37H32N2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine |
| SMILES | CC(C)(c1ccc(-c2ccccc2)cc1)c1ccc(C2N=C(c3ccccc3)C=C(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C37H32N2/c1-37(2,32-22-18-28(19-23-32)27-12-6-3-7-13-27)33-24-20-31(21-25-33)36-38-34(29-14-8-4-9-15-29)26-35(39-36)30-16-10-5-11-17-30/h3-26,36,38H,1-2H3 |
| InChIKey | DXYQKXZTPHMLOZ-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine?
The IUPAC name of 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine (CID 130392498) is 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine.
What is the SMILES notation for 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine?
The canonical SMILES for 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine is CC(C)(c1ccc(-c2ccccc2)cc1)c1ccc(C2N=C(c3ccccc3)C=C(c3ccccc3)N2)cc1.
What is the InChIKey of 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine?
The InChIKey is DXYQKXZTPHMLOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H32N2/c1-37(2,32-22-18-28(19-23-32)27-12-6-3-7-13-27)33-24-20-31(21-25-33)36-38-34(29-14-8-4-9-15-29)26-35(39-36)30-16-10-5-11-17-30/h3-26,36,38H,1-2H3.
What are the key properties of 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine?
4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine has a molecular weight of 504.68 g/mol, XLogP of 8.81, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diphenyl-2-[4-[2-(4-phenylphenyl)propan-2-yl]phenyl]-1,2-dihydropyrimidine is sourced from PubChem (CID 130392498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).