C28H23N3 — CID 118585090
3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline (PubChem CID 118585090) has the molecular formula C28H23N3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline.
| Compound Name | 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline |
|---|---|
| PubChem CID | 118585090 |
| Molecular Formula | C28H23N3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline |
| SMILES | Nc1cc(-c2ccccc2)cc(C2N=C(c3ccccc3)C=C(c3ccccc3)N2)c1 |
| InChI | InChI=1S/C28H23N3/c29-25-17-23(20-10-4-1-5-11-20)16-24(18-25)28-30-26(21-12-6-2-7-13-21)19-27(31-28)22-14-8-3-9-15-22/h1-19,28,30H,29H2 |
| InChIKey | JHAHINYZPZIDOK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|