About 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline
3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline (PubChem CID 118585090) has the molecular formula C28H23N3
and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline.
Molecular Properties
| Compound Name | 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline |
| PubChem CID | 118585090 |
| Molecular Formula | C28H23N3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline |
| SMILES | Nc1cc(-c2ccccc2)cc(C2N=C(c3ccccc3)C=C(c3ccccc3)N2)c1 |
| InChI | InChI=1S/C28H23N3/c29-25-17-23(20-10-4-1-5-11-20)16-24(18-25)28-30-26(21-12-6-2-7-13-21)19-27(31-28)22-14-8-3-9-15-22/h1-19,28,30H,29H2 |
| InChIKey | JHAHINYZPZIDOK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline?
The IUPAC name of 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline (CID 118585090) is 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline.
What is the SMILES notation for 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline?
The canonical SMILES for 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline is Nc1cc(-c2ccccc2)cc(C2N=C(c3ccccc3)C=C(c3ccccc3)N2)c1.
What is the InChIKey of 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline?
The InChIKey is JHAHINYZPZIDOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23N3/c29-25-17-23(20-10-4-1-5-11-20)16-24(18-25)28-30-26(21-12-6-2-7-13-21)19-27(31-28)22-14-8-3-9-15-22/h1-19,28,30H,29H2.
What are the key properties of 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline?
3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline has a molecular weight of 401.51 g/mol, XLogP of 6.07, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-diphenyl-1,2-dihydropyrimidin-2-yl)-5-phenylaniline is sourced from PubChem (CID 118585090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).