C52H36N6 — CID 139339084
2-[4-[6-[4-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 139339084) has the molecular formula C52H36N6 and a molecular weight of 744.90 g/mol. Its IUPAC name is 2-[4-[6-[4-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[6-[4-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 139339084 |
| Molecular Formula | C52H36N6 |
| Molecular Weight | 744.90 g/mol |
| Exact Mass | 744.30 |
| IUPAC Name | 2-[4-[6-[4-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3ccc(-c4ccc5cc(-c6ccc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)cc6)ccc5c4)cc3)NC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C52H36N6/c1-5-13-37(14-6-1)47-53-48(38-15-7-2-8-16-38)56-51(55-47)41-25-21-35(22-26-41)43-29-31-46-34-44(30-32-45(46)33-43)36-23-27-42(28-24-36)52-57-49(39-17-9-3-10-18-39)54-50(58-52)40-19-11-4-12-20-40/h1-34,51H,(H,53,55,56) |
| InChIKey | LWIJFPNGLPNUJI-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.90 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |