C60H46N6 — CID 174300049
2-[3-[3-[4-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4-phenyl-6-spiro[cyclohexane-1,9'-fluorene]-4'-yl-1,3,5-triazine (PubChem CID 174300049) has the molecular formula C60H46N6 and a molecular weight of 851.07 g/mol. Its IUPAC name is 2-[3-[3-[4-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4-phenyl-6-spiro[cyclohexane-1,9'-fluorene]-4'-yl-1,3,5-triazine.
| Compound Name | 2-[3-[3-[4-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4-phenyl-6-spiro[cyclohexane-1,9'-fluorene]-4'-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 174300049 |
| Molecular Formula | C60H46N6 |
| Molecular Weight | 851.07 g/mol |
| Exact Mass | 850.38 |
| IUPAC Name | 2-[3-[3-[4-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-4-phenyl-6-spiro[cyclohexane-1,9'-fluorene]-4'-yl-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3ccc(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc(-c7cccc8c7-c7ccccc7C87CCCCC7)n6)c5)c4)cc3)NC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C60H46N6/c1-5-18-41(19-6-1)54-61-55(42-20-7-2-8-21-42)63-57(62-54)44-34-32-40(33-35-44)45-24-15-25-46(38-45)47-26-16-27-48(39-47)58-64-56(43-22-9-3-10-23-43)65-59(66-58)50-29-17-31-52-53(50)49-28-11-12-30-51(49)60(52)36-13-4-14-37-60/h1-3,5-12,15-35,38-39,57H,4,13-14,36-37H2,(H,61,62,63) |
| InChIKey | HNXFHNZDCOHTLG-UHFFFAOYSA-N |
| XLogP | 13.93 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.07 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |