C67H44N6 — CID 88890940
2-phenyl-4-(4-phenylphenyl)-6-[2-[2-phenyl-6-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]-9,9'-spirobi[fluorene]-2'-yl]-1,3,5-triazine (PubChem CID 88890940) has the molecular formula C67H44N6 and a molecular weight of 933.13 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-[2-[2-phenyl-6-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]-9,9'-spirobi[fluorene]-2'-yl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-[2-[2-phenyl-6-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]-9,9'-spirobi[fluorene]-2'-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 88890940 |
| Molecular Formula | C67H44N6 |
| Molecular Weight | 933.13 g/mol |
| Exact Mass | 932.36 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-[2-[2-phenyl-6-(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-4-yl]-9,9'-spirobi[fluorene]-2'-yl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(C3=NC(c4ccc5c(c4)C4(c6ccccc6-5)c5ccccc5-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccc(-c8ccccc8)cc7)n6)cc54)=NC(c4ccccc4)N3)cc2)cc1 |
| InChI | InChI=1S/C67H44N6/c1-5-17-43(18-6-1)45-29-33-49(34-30-45)63-68-61(47-21-9-3-10-22-47)70-65(72-63)51-37-39-55-53-25-13-15-27-57(53)67(59(55)41-51)58-28-16-14-26-54(58)56-40-38-52(42-60(56)67)66-71-62(48-23-11-4-12-24-48)69-64(73-66)50-35-31-46(32-36-50)44-19-7-2-8-20-44/h1-42,61H,(H,68,70,72) |
| InChIKey | AZSUNLCDZSXQKE-UHFFFAOYSA-N |
| XLogP | 15.05 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.13 |
| LogP ≤ 5 | 15.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |