C51H35N3S — CID 156574841
4-[4,6-bis(3-phenylphenyl)dibenzothiophen-1-yl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine (PubChem CID 156574841) has the molecular formula C51H35N3S and a molecular weight of 721.93 g/mol. Its IUPAC name is 4-[4,6-bis(3-phenylphenyl)dibenzothiophen-1-yl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine.
| Compound Name | 4-[4,6-bis(3-phenylphenyl)dibenzothiophen-1-yl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 156574841 |
| Molecular Formula | C51H35N3S |
| Molecular Weight | 721.93 g/mol |
| Exact Mass | 721.26 |
| IUPAC Name | 4-[4,6-bis(3-phenylphenyl)dibenzothiophen-1-yl]-2,6-diphenyl-1,2-dihydro-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3ccc(-c4cccc(-c5ccccc5)c4)c4sc5c(-c6cccc(-c7ccccc7)c6)cccc5c34)=NC(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C51H35N3S/c1-5-16-34(17-6-1)38-24-13-26-40(32-38)42-28-15-29-44-46-45(51-53-49(36-20-9-3-10-21-36)52-50(54-51)37-22-11-4-12-23-37)31-30-43(48(46)55-47(42)44)41-27-14-25-39(33-41)35-18-7-2-8-19-35/h1-33,49H,(H,52,53,54) |
| InChIKey | NUIXAFIRWIJHIV-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.93 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |