C58H38N6S — CID 142453353
2-naphthalen-1-yl-4-phenyl-6-[4-[4-[2-phenyl-4-(2-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]dibenzothiophen-1-yl]-1,3,5-triazine (PubChem CID 142453353) has the molecular formula C58H38N6S and a molecular weight of 851.05 g/mol. Its IUPAC name is 2-naphthalen-1-yl-4-phenyl-6-[4-[4-[2-phenyl-4-(2-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]dibenzothiophen-1-yl]-1,3,5-triazine.
| Compound Name | 2-naphthalen-1-yl-4-phenyl-6-[4-[4-[2-phenyl-4-(2-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]dibenzothiophen-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 142453353 |
| Molecular Formula | C58H38N6S |
| Molecular Weight | 851.05 g/mol |
| Exact Mass | 850.29 |
| IUPAC Name | 2-naphthalen-1-yl-4-phenyl-6-[4-[4-[2-phenyl-4-(2-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]dibenzothiophen-1-yl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3cccc4ccccc34)nc(-c3ccc(-c4ccc(C5=NC(c6ccccc6-c6ccccc6)=NC(c6ccccc6)N5)cc4)c4sc5ccccc5c34)n2)cc1 |
| InChI | InChI=1S/C58H38N6S/c1-4-17-37(18-5-1)43-26-12-13-27-46(43)56-60-53(40-20-6-2-7-21-40)59-55(62-56)42-33-31-39(32-34-42)45-35-36-49(51-48-28-14-15-30-50(48)65-52(45)51)58-63-54(41-22-8-3-9-23-41)61-57(64-58)47-29-16-24-38-19-10-11-25-44(38)47/h1-36,53H,(H,59,60,62) |
| InChIKey | DOQZZXRSWCXGBI-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.05 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |