C62H44N6S — CID 154955591
2-[4-[6-(3-methylphenyl)-2-[3-[2-(3-methylphenyl)-4-phenyl-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]dibenzothiophen-4-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 154955591) has the molecular formula C62H44N6S and a molecular weight of 905.14 g/mol. Its IUPAC name is 2-[4-[6-(3-methylphenyl)-2-[3-[2-(3-methylphenyl)-4-phenyl-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]dibenzothiophen-4-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[6-(3-methylphenyl)-2-[3-[2-(3-methylphenyl)-4-phenyl-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]dibenzothiophen-4-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 154955591 |
| Molecular Formula | C62H44N6S |
| Molecular Weight | 905.14 g/mol |
| Exact Mass | 904.33 |
| IUPAC Name | 2-[4-[6-(3-methylphenyl)-2-[3-[2-(3-methylphenyl)-4-phenyl-1,2-dihydro-1,3,5-triazin-6-yl]phenyl]dibenzothiophen-4-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1cccc(-c2cccc3c2sc2c(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)cc(-c4cccc(C5=NC(c6ccccc6)=NC(c6cccc(C)c6)N5)c4)cc23)c1 |
| InChI | InChI=1S/C62H44N6S/c1-39-16-12-25-47(34-39)51-28-15-29-52-54-38-50(46-24-14-27-49(36-46)62-67-59(44-22-10-5-11-23-44)66-61(68-62)48-26-13-17-40(2)35-48)37-53(56(54)69-55(51)52)41-30-32-45(33-31-41)60-64-57(42-18-6-3-7-19-42)63-58(65-60)43-20-8-4-9-21-43/h3-38,61H,1-2H3,(H,66,67,68) |
| InChIKey | URZMRDAJJKKALL-UHFFFAOYSA-N |
| XLogP | 15.35 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.14 |
| LogP ≤ 5 | 15.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |