C60H41N7 — CID 146648799
3-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,9-diphenylcarbazole (PubChem CID 146648799) has the molecular formula C60H41N7 and a molecular weight of 860.04 g/mol. Its IUPAC name is 3-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,9-diphenylcarbazole.
| Compound Name | 3-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,9-diphenylcarbazole |
|---|---|
| PubChem CID | 146648799 |
| Molecular Formula | C60H41N7 |
| Molecular Weight | 860.04 g/mol |
| Exact Mass | 859.34 |
| IUPAC Name | 3-[4-(2,6-diphenyl-1,2-dihydro-1,3,5-triazin-4-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,9-diphenylcarbazole |
| SMILES | c1ccc(C2=NC(c3ccc(-c4cc(-c5ccccc5)c5c(c4)c4ccccc4n5-c4ccccc4)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)=NC(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C60H41N7/c1-7-21-40(22-8-1)50-38-46(39-51-49-33-19-20-34-53(49)67(54(50)51)47-31-17-6-18-32-47)48-36-35-45(59-63-55(41-23-9-2-10-24-41)61-56(64-59)42-25-11-3-12-26-42)37-52(48)60-65-57(43-27-13-4-14-28-43)62-58(66-60)44-29-15-5-16-30-44/h1-39,55H,(H,61,63,64) |
| InChIKey | ZZBRVORPAQUCSO-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 80.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.04 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |