C60H40N8 — CID 162498267
11-[3-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]-12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-a]carbazole (PubChem CID 162498267) has the molecular formula C60H40N8 and a molecular weight of 873.04 g/mol. Its IUPAC name is 11-[3-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]-12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-a]carbazole.
| Compound Name | 11-[3-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]-12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 162498267 |
| Molecular Formula | C60H40N8 |
| Molecular Weight | 873.04 g/mol |
| Exact Mass | 872.34 |
| IUPAC Name | 11-[3-(4,6-diphenyl-1,2-dihydro-1,3,5-triazin-2-yl)phenyl]-12-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]indolo[2,3-a]carbazole |
| SMILES | c1ccc(C2=NC(c3cccc(-n4c5ccccc5c5ccc6c7ccccc7n(-c7cccc(-c8nc(-c9ccccc9)nc(-c9ccccc9)n8)c7)c6c54)c3)NC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C60H40N8/c1-5-19-39(20-6-1)55-61-56(40-21-7-2-8-22-40)64-59(63-55)43-27-17-29-45(37-43)67-51-33-15-13-31-47(51)49-35-36-50-48-32-14-16-34-52(48)68(54(50)53(49)67)46-30-18-28-44(38-46)60-65-57(41-23-9-3-10-24-41)62-58(66-60)42-25-11-4-12-26-42/h1-38,59H,(H,61,63,64) |
| InChIKey | CBAQPMXUYNTJHY-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.04 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |