C44H43N3 — CID 146531632
6-(4b,9,9-trimethyl-8aH-fluoren-2-yl)-4-(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-2-naphthalen-2-yl-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 146531632) has the molecular formula C44H43N3 and a molecular weight of 613.85 g/mol. Its IUPAC name is 6-(4b,9,9-trimethyl-8aH-fluoren-2-yl)-4-(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-2-naphthalen-2-yl-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 6-(4b,9,9-trimethyl-8aH-fluoren-2-yl)-4-(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-2-naphthalen-2-yl-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 146531632 |
| Molecular Formula | C44H43N3 |
| Molecular Weight | 613.85 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | 6-(4b,9,9-trimethyl-8aH-fluoren-2-yl)-4-(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-2-naphthalen-2-yl-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | CC1(C)C2=C(C=CCC2)c2ccc(C3N=C(c4ccc5c(c4)C(C)(C)C4C=CC=CC54C)NC(c4ccc5ccccc5c4)N3)cc21 |
| InChI | InChI=1S/C44H43N3/c1-42(2)34-15-9-8-14-32(34)33-21-19-30(25-36(33)42)40-45-39(29-18-17-27-12-6-7-13-28(27)24-29)46-41(47-40)31-20-22-35-37(26-31)43(3,4)38-16-10-11-23-44(35,38)5/h6-8,10-14,16-26,38-40,45H,9,15H2,1-5H3,(H,46,47) |
| InChIKey | SGCYAUYBMZJSFK-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.85 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |