C52H44N6 — CID 174300944
2-cyclohexa-2,4-dien-1-yl-6-[4-[7-[4-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]phenyl]-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 174300944) has the molecular formula C52H44N6 and a molecular weight of 752.97 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-6-[4-[7-[4-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]phenyl]-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-6-[4-[7-[4-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]phenyl]-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 174300944 |
| Molecular Formula | C52H44N6 |
| Molecular Weight | 752.97 g/mol |
| Exact Mass | 752.36 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-6-[4-[7-[4-(4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-2-yl)phenyl]naphthalen-2-yl]phenyl]-4-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | C1=CCC(C2NC(c3ccc(-c4ccc5ccc(-c6ccc(C7NC(c8ccccc8)=NC(c8ccccc8)N7)cc6)cc5c4)cc3)=NC(c3ccccc3)N2)C=C1 |
| InChI | InChI=1S/C52H44N6/c1-5-13-38(14-6-1)47-53-48(39-15-7-2-8-16-39)56-51(55-47)42-27-21-35(22-28-42)44-31-25-37-26-32-45(34-46(37)33-44)36-23-29-43(30-24-36)52-57-49(40-17-9-3-10-18-40)54-50(58-52)41-19-11-4-12-20-41/h1-19,21-34,41,47,49-51,54-55H,20H2,(H,53,56)(H,57,58) |
| InChIKey | ABTCABZXBAEDLB-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.97 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |