C28H25N3 — CID 129128255
4-[3-(3-methylphenyl)phenyl]-2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 129128255) has the molecular formula C28H25N3 and a molecular weight of 403.53 g/mol. Its IUPAC name is 4-[3-(3-methylphenyl)phenyl]-2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 4-[3-(3-methylphenyl)phenyl]-2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 129128255 |
| Molecular Formula | C28H25N3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 4-[3-(3-methylphenyl)phenyl]-2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | Cc1cccc(-c2cccc(C3N=C(c4ccccc4)NC(c4ccccc4)N3)c2)c1 |
| InChI | InChI=1S/C28H25N3/c1-20-10-8-15-23(18-20)24-16-9-17-25(19-24)28-30-26(21-11-4-2-5-12-21)29-27(31-28)22-13-6-3-7-14-22/h2-19,26,28,30H,1H3,(H,29,31) |
| InChIKey | HUYWXIQRTBLZQB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |