C70H55N3 — CID 126699625
2-[3-(3,5-diphenylphenyl)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]-4-[3-(3,5-diphenylphenyl)-5-phenylphenyl]-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 126699625) has the molecular formula C70H55N3 and a molecular weight of 938.23 g/mol. Its IUPAC name is 2-[3-(3,5-diphenylphenyl)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]-4-[3-(3,5-diphenylphenyl)-5-phenylphenyl]-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 2-[3-(3,5-diphenylphenyl)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]-4-[3-(3,5-diphenylphenyl)-5-phenylphenyl]-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 126699625 |
| Molecular Formula | C70H55N3 |
| Molecular Weight | 938.23 g/mol |
| Exact Mass | 937.44 |
| IUPAC Name | 2-[3-(3,5-diphenylphenyl)-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]phenyl]-4-[3-(3,5-diphenylphenyl)-5-phenylphenyl]-6-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | C=C(/C=C\C=C/C)c1cc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)cc(C2NC(c3ccccc3)=NC(c3cc(-c4ccccc4)cc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c3)N2)c1 |
| InChI | InChI=1S/C70H55N3/c1-3-4-11-24-49(2)56-37-62(63-41-57(50-25-12-5-13-26-50)39-58(42-63)51-27-14-6-15-28-51)47-66(38-56)69-71-68(55-35-22-10-23-36-55)72-70(73-69)67-46-61(54-33-20-9-21-34-54)45-65(48-67)64-43-59(52-29-16-7-17-30-52)40-60(44-64)53-31-18-8-19-32-53/h3-48,69-70,73H,2H2,1H3,(H,71,72)/b4-3-,24-11- |
| InChIKey | FZNUFYAHBFZCJA-FGVSTFSOSA-N |
| XLogP | 17.84 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.23 |
| LogP ≤ 5 | 17.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|