C54H46N4 — CID 129201266
6-[6-[3-(4-tert-butylphenyl)-5-(2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]-4a,5-dihydrophenanthridine (PubChem CID 129201266) has the molecular formula C54H46N4 and a molecular weight of 750.99 g/mol. Its IUPAC name is 6-[6-[3-(4-tert-butylphenyl)-5-(2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]-4a,5-dihydrophenanthridine.
| Compound Name | 6-[6-[3-(4-tert-butylphenyl)-5-(2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]-4a,5-dihydrophenanthridine |
|---|---|
| PubChem CID | 129201266 |
| Molecular Formula | C54H46N4 |
| Molecular Weight | 750.99 g/mol |
| Exact Mass | 750.37 |
| IUPAC Name | 6-[6-[3-(4-tert-butylphenyl)-5-(2,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)phenyl]naphthalen-1-yl]-4a,5-dihydrophenanthridine |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc4c(C5=c6ccccc6=C6C=CC=CC6N5)cccc4c3)cc(C3N=C(c4ccccc4)NC(c4ccccc4)N3)c2)cc1 |
| InChI | InChI=1S/C54H46N4/c1-54(2,3)43-28-25-35(26-29-43)40-32-41(34-42(33-40)53-57-51(36-15-6-4-7-16-36)56-52(58-53)37-17-8-5-9-18-37)38-27-30-44-39(31-38)19-14-23-47(44)50-48-22-11-10-20-45(48)46-21-12-13-24-49(46)55-50/h4-34,49,51,53,55,57H,1-3H3,(H,56,58) |
| InChIKey | RQFHMOQCCMWZHP-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.99 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |