C40H31Cl2N7 — CID 145390200
N'-(4,6-dichloropyrimidin-2-yl)-1-[4-[4-(2,4-dinaphthalen-2-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)phenyl]phenyl]methanediamine (PubChem CID 145390200) has the molecular formula C40H31Cl2N7 and a molecular weight of 680.64 g/mol. Its IUPAC name is N'-(4,6-dichloropyrimidin-2-yl)-1-[4-[4-(2,4-dinaphthalen-2-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)phenyl]phenyl]methanediamine.
| Compound Name | N'-(4,6-dichloropyrimidin-2-yl)-1-[4-[4-(2,4-dinaphthalen-2-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)phenyl]phenyl]methanediamine |
|---|---|
| PubChem CID | 145390200 |
| Molecular Formula | C40H31Cl2N7 |
| Molecular Weight | 680.64 g/mol |
| Exact Mass | 679.20 |
| IUPAC Name | N'-(4,6-dichloropyrimidin-2-yl)-1-[4-[4-(2,4-dinaphthalen-2-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl)phenyl]phenyl]methanediamine |
| SMILES | NC(Nc1nc(Cl)cc(Cl)n1)c1ccc(-c2ccc(C3=NC(c4ccc5ccccc5c4)NC(c4ccc5ccccc5c4)N3)cc2)cc1 |
| InChI | InChI=1S/C40H31Cl2N7/c41-34-23-35(42)45-40(44-34)46-36(43)28-15-9-26(10-16-28)27-11-17-29(18-12-27)37-47-38(32-19-13-24-5-1-3-7-30(24)21-32)49-39(48-37)33-20-14-25-6-2-4-8-31(25)22-33/h1-23,36,38-39,49H,43H2,(H,47,48)(H,44,45,46) |
| InChIKey | UDFNPXVFTCMBCV-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.64 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|