C43H37N3 — CID 146359376
2-(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-4-(9,9-dimethylfluoren-2-yl)-6-naphthalen-2-yl-1,4-dihydro-1,3,5-triazine (PubChem CID 146359376) has the molecular formula C43H37N3 and a molecular weight of 595.79 g/mol. Its IUPAC name is 2-(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-4-(9,9-dimethylfluoren-2-yl)-6-naphthalen-2-yl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-4-(9,9-dimethylfluoren-2-yl)-6-naphthalen-2-yl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 146359376 |
| Molecular Formula | C43H37N3 |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | 2-(9,9-dimethyl-7,8-dihydrofluoren-2-yl)-4-(9,9-dimethylfluoren-2-yl)-6-naphthalen-2-yl-1,4-dihydro-1,3,5-triazine |
| SMILES | CC1(C)C2=C(C=CCC2)c2ccc(C3=NC(c4ccc5c(c4)C(C)(C)c4ccccc4-5)N=C(c4ccc5ccccc5c4)N3)cc21 |
| InChI | InChI=1S/C43H37N3/c1-42(2)35-15-9-7-13-31(35)33-21-19-29(24-37(33)42)40-44-39(28-18-17-26-11-5-6-12-27(26)23-28)45-41(46-40)30-20-22-34-32-14-8-10-16-36(32)43(3,4)38(34)25-30/h5-9,11-15,17-25,40H,10,16H2,1-4H3,(H,44,45,46) |
| InChIKey | NJCLCXZWEHXZKM-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |