C43H36N3+ — CID 144869007
2,6-bis(9,9-dimethylfluoren-2-yl)-4-naphthalen-2-yl-1,2-dihydro-1,3,5-triazin-1-ium (PubChem CID 144869007) has the molecular formula C43H36N3+ and a molecular weight of 594.78 g/mol. Its IUPAC name is 2,6-bis(9,9-dimethylfluoren-2-yl)-4-naphthalen-2-yl-1,2-dihydro-1,3,5-triazin-1-ium.
| Compound Name | 2,6-bis(9,9-dimethylfluoren-2-yl)-4-naphthalen-2-yl-1,2-dihydro-1,3,5-triazin-1-ium |
|---|---|
| PubChem CID | 144869007 |
| Molecular Formula | C43H36N3+ |
| Molecular Weight | 594.78 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | 2,6-bis(9,9-dimethylfluoren-2-yl)-4-naphthalen-2-yl-1,2-dihydro-1,3,5-triazin-1-ium |
| SMILES | CC1(C)c2ccccc2-c2ccc(C3=NC(c4ccc5ccccc5c4)=NC(c4ccc5c(c4)C(C)(C)c4ccccc4-5)[NH2+]3)cc21 |
| InChI | InChI=1S/C43H35N3/c1-42(2)35-15-9-7-13-31(35)33-21-19-29(24-37(33)42)40-44-39(28-18-17-26-11-5-6-12-27(26)23-28)45-41(46-40)30-20-22-34-32-14-8-10-16-36(32)43(3,4)38(34)25-30/h5-25,40H,1-4H3,(H,44,45,46)/p+1 |
| InChIKey | VTCYZXLFUZFXGP-UHFFFAOYSA-O |
| XLogP | 8.92 |
| TPSA | 41.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.78 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |