C11H12O2S — CID 121321813
6-methylsulfonyl-1,2-dihydronaphthalene (PubChem CID 121321813) has the molecular formula C11H12O2S and a molecular weight of 208.28 g/mol. Its IUPAC name is 6-methylsulfonyl-1,2-dihydronaphthalene.
| Compound Name | 6-methylsulfonyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 121321813 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 6-methylsulfonyl-1,2-dihydronaphthalene |
| SMILES | CS(=O)(=O)c1ccc2c(c1)C=CCC2 |
| InChI | InChI=1S/C11H12O2S/c1-14(12,13)11-7-6-9-4-2-3-5-10(9)8-11/h3,5-8H,2,4H2,1H3 |
| InChIKey | WDOVMCHMRRUJIF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |