C10H13NO2S — CID 23336575
7-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 23336575) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 7-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 7-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 23336575 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 7-methylsulfonyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C10H13NO2S/c1-14(12,13)10-3-2-8-4-5-11-7-9(8)6-10/h2-3,6,11H,4-5,7H2,1H3 |
| InChIKey | NGBCJESOVZUCBJ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |