C12H12O2 — CID 56680136
3-methoxy-5,6-dihydronaphthalene-2-carbaldehyde (PubChem CID 56680136) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-methoxy-5,6-dihydronaphthalene-2-carbaldehyde.
| Compound Name | 3-methoxy-5,6-dihydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 56680136 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3-methoxy-5,6-dihydronaphthalene-2-carbaldehyde |
| SMILES | COc1cc2c(cc1C=O)C=CCC2 |
| InChI | InChI=1S/C12H12O2/c1-14-12-7-10-5-3-2-4-9(10)6-11(12)8-13/h2,4,6-8H,3,5H2,1H3 |
| InChIKey | SZMJBTXXODAKHB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|