C12H20N6O3 — CID 141009291
6-methoxy-3,3-bis(triaminomethyl)-1H-2-benzofuran-5-carbaldehyde (PubChem CID 141009291) has the molecular formula C12H20N6O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 6-methoxy-3,3-bis(triaminomethyl)-1H-2-benzofuran-5-carbaldehyde.
| Compound Name | 6-methoxy-3,3-bis(triaminomethyl)-1H-2-benzofuran-5-carbaldehyde |
|---|---|
| PubChem CID | 141009291 |
| Molecular Formula | C12H20N6O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 6-methoxy-3,3-bis(triaminomethyl)-1H-2-benzofuran-5-carbaldehyde |
| SMILES | COc1cc2c(cc1C=O)C(C(N)(N)N)(C(N)(N)N)OC2 |
| InChI | InChI=1S/C12H20N6O3/c1-20-9-3-7-5-21-10(11(13,14)15,12(16,17)18)8(7)2-6(9)4-19/h2-4H,5,13-18H2,1H3 |
| InChIKey | WQBSYWAOTBMDLT-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 191.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|