C10H15F — CID 145449186
1-fluoro-2-(2-methylpropyl)cyclohexa-1,3-diene (PubChem CID 145449186) has the molecular formula C10H15F and a molecular weight of 154.23 g/mol. Its IUPAC name is 1-fluoro-2-(2-methylpropyl)cyclohexa-1,3-diene.
| Compound Name | 1-fluoro-2-(2-methylpropyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 145449186 |
| Molecular Formula | C10H15F |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 1-fluoro-2-(2-methylpropyl)cyclohexa-1,3-diene |
| SMILES | CC(C)CC1=C(F)CCC=C1 |
| InChI | InChI=1S/C10H15F/c1-8(2)7-9-5-3-4-6-10(9)11/h3,5,8H,4,6-7H2,1-2H3 |
| InChIKey | HWILUPFSULUTKZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |