C8H11FV — CID 178170510
1-ethyl-2-fluorocyclohexa-1,3-diene;vanadium (PubChem CID 178170510) has the molecular formula C8H11FV and a molecular weight of 177.12 g/mol. Its IUPAC name is 1-ethyl-2-fluorocyclohexa-1,3-diene;vanadium.
| Compound Name | 1-ethyl-2-fluorocyclohexa-1,3-diene;vanadium |
|---|---|
| PubChem CID | 178170510 |
| Molecular Formula | C8H11FV |
| Molecular Weight | 177.12 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | 1-ethyl-2-fluorocyclohexa-1,3-diene;vanadium |
| SMILES | CCC1=C(F)C=CCC1.[V] |
| InChI | InChI=1S/C8H11F.V/c1-2-7-5-3-4-6-8(7)9;/h4,6H,2-3,5H2,1H3; |
| InChIKey | ZAWMHKSCDHABPX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.12 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |