C12H18S — CID 167246313
4-(2-ethylcyclohexa-1,5-dien-1-yl)but-1-ene-2-thiol (PubChem CID 167246313) has the molecular formula C12H18S and a molecular weight of 194.34 g/mol. Its IUPAC name is 4-(2-ethylcyclohexa-1,5-dien-1-yl)but-1-ene-2-thiol.
| Compound Name | 4-(2-ethylcyclohexa-1,5-dien-1-yl)but-1-ene-2-thiol |
|---|---|
| PubChem CID | 167246313 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 4-(2-ethylcyclohexa-1,5-dien-1-yl)but-1-ene-2-thiol |
| SMILES | C=C(S)CCC1=C(CC)CCC=C1 |
| InChI | InChI=1S/C12H18S/c1-3-11-6-4-5-7-12(11)9-8-10(2)13/h5,7,13H,2-4,6,8-9H2,1H3 |
| InChIKey | PKTPSBBKGPFRCQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|