About N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine
N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine (PubChem CID 165142320) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine |
| PubChem CID | 165142320 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine |
| SMILES | CCNCC1=C(OC)CCC=C1 |
| InChI | InChI=1S/C10H17NO/c1-3-11-8-9-6-4-5-7-10(9)12-2/h4,6,11H,3,5,7-8H2,1-2H3 |
| InChIKey | UCLKRCKLOGOGHD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine?
The IUPAC name of N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine (CID 165142320) is N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine.
What is the SMILES notation for N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine?
The canonical SMILES for N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine is CCNCC1=C(OC)CCC=C1.
What is the InChIKey of N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine?
The InChIKey is UCLKRCKLOGOGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-3-11-8-9-6-4-5-7-10(9)12-2/h4,6,11H,3,5,7-8H2,1-2H3.
What are the key properties of N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine?
N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine has a molecular weight of 167.25 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]ethanamine is sourced from PubChem (CID 165142320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).