C12H19NO2 — CID 91452755
1-methanidyl-4,5-bis(2-methoxyethenyl)-1,2,3,6-tetrahydropyridin-1-ium (PubChem CID 91452755) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-methanidyl-4,5-bis(2-methoxyethenyl)-1,2,3,6-tetrahydropyridin-1-ium.
| Compound Name | 1-methanidyl-4,5-bis(2-methoxyethenyl)-1,2,3,6-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 91452755 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-methanidyl-4,5-bis(2-methoxyethenyl)-1,2,3,6-tetrahydropyridin-1-ium |
| SMILES | [CH2-][NH+]1CCC(C=COC)=C(C=COC)C1 |
| InChI | InChI=1S/C12H19NO2/c1-13-7-4-11(5-8-14-2)12(10-13)6-9-15-3/h5-6,8-9,13H,1,4,7,10H2,2-3H3 |
| InChIKey | AGVVTONBJZLOAN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|