C15H28N2O — CID 164861324
N'-ethyl-N'-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]-N-methylbutane-1,4-diamine (PubChem CID 164861324) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is N'-ethyl-N'-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]-N-methylbutane-1,4-diamine.
| Compound Name | N'-ethyl-N'-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 164861324 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | N'-ethyl-N'-[(2-methoxycyclohexa-1,5-dien-1-yl)methyl]-N-methylbutane-1,4-diamine |
| SMILES | CCN(CCCCNC)CC1=C(OC)CCC=C1 |
| InChI | InChI=1S/C15H28N2O/c1-4-17(12-8-7-11-16-2)13-14-9-5-6-10-15(14)18-3/h5,9,16H,4,6-8,10-13H2,1-3H3 |
| InChIKey | RELBNDKYEZNLJI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|